2-N-BUTOXYETHYL METHACRYLATE CAS#13532-94-0
Enhanced Polymer Flexibility: BEM introduces a butoxyethyl group into polymer formulations, improving flexibility and helping produce materials with better mechanical performance.
Excellent Weather Resistance: It enhances the durability and weathering resistance of polymer systems, making it suitable for long-lasting outdoor applications.
Improved Hydrophobic Properties: BEM provides increased water resistance and hydrophobicity, contributing to improved protection and stability of finished products.
Versatile Application Performance: As an acrylic specialty monomer, BEM is widely used in protective coatings, industrial resins, and adhesives to optimize formulation performance.
2-n-Butoxyethyl Methacrylate (BEM) CAS#13532-94-0
2-n-Butoxyethyl methacrylate (BEM), with CAS No. 13532-94-0, is a specialty acrylic monomer. Containing a butoxyethyl functional group, it can enhance the flexibility, weather resistance, and hydrophobic properties of polymer formulations. BEM is widely applied in protective coatings, industrial resin systems, and adhesive formulations.
| English Name | 2-N-BUTOXYETHYL METHACRYLATE |
| English Synonyms | 2-Butoxyethylmethacrylate;2-Propenoicacid,2-methyl-,2-butoxyethylester;2-N-BUTOXYETHYL METHACRYL ATE;N-BUTOXY ETHYL METHACRYLATE;2-n-Butoxyethyl methacrylate 13532-94-0;Ethylene glycol butyl ether methacrylate;Methacrylic acid (3-oxaheptan-1-yl) ester;Methacrylic acid 2-butoxyethyl ester |
| CAS Number | 13532-94-0 |
| Molecular Formula | C10H1803 |
| Molecular Weight | 186.25 |
| EINECS Number | 236-885-7 |
| Melting point | 90~92℃/3mm |
| Boiling point | 90-92°C 3mm |
| Density | 0.939 g/mL at 25 °C(lit.) |
| Vapor pressure | 99Pa at 20℃ |
| Refractive index | n20/D 1.4335(lit.) |
| Flash point | 93℃ |
| Water solubility | 1.007g/L at 25℃ |
| InChI | InChI=1S/C10H1803/c1-4-5-6-12-7-8-13-10(11)9(2)3/h2,4-8H2,1,3H3 |
| InChIKey | DJKKWVGWYCKUFC-UHFFFAOYSA-N |
| Smiles | C(OCCOCCCC)(=O)C(C)=C |
| LogP | 2.47 at 25℃ |
